About 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate
1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate (PubChem CID 91707252) has the molecular formula C18H26O5
and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate |
| PubChem CID | 91707252 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate |
| SMILES | CC(C)COC(=O)CCCC(=O)Oc1ccccc1OC(C)C |
| InChI | InChI=1S/C18H26O5/c1-13(2)12-21-17(19)10-7-11-18(20)23-16-9-6-5-8-15(16)22-14(3)4/h5-6,8-9,13-14H,7,10-12H2,1-4H3 |
| InChIKey | UFXBHOHVQLFRST-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate?
The IUPAC name of 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate (CID 91707252) is 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate.
What is the SMILES notation for 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate?
The canonical SMILES for 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate is CC(C)COC(=O)CCCC(=O)Oc1ccccc1OC(C)C.
What is the InChIKey of 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate?
The InChIKey is UFXBHOHVQLFRST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O5/c1-13(2)12-21-17(19)10-7-11-18(20)23-16-9-6-5-8-15(16)22-14(3)4/h5-6,8-9,13-14H,7,10-12H2,1-4H3.
What are the key properties of 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate?
1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate has a molecular weight of 322.40 g/mol, XLogP of 3.75, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-methylpropyl) 5-O-(2-propan-2-yloxyphenyl) pentanedioate is sourced from PubChem (CID 91707252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).