C16H22O4S — CID 91707964
1-O-(2-methylpropyl) 5-O-(2-methylsulfanylphenyl) pentanedioate (PubChem CID 91707964) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 5-O-(2-methylsulfanylphenyl) pentanedioate.
| Compound Name | 1-O-(2-methylpropyl) 5-O-(2-methylsulfanylphenyl) pentanedioate |
|---|---|
| PubChem CID | 91707964 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-O-(2-methylpropyl) 5-O-(2-methylsulfanylphenyl) pentanedioate |
| SMILES | CSc1ccccc1OC(=O)CCCC(=O)OCC(C)C |
| InChI | InChI=1S/C16H22O4S/c1-12(2)11-19-15(17)9-6-10-16(18)20-13-7-4-5-8-14(13)21-3/h4-5,7-8,12H,6,9-11H2,1-3H3 |
| InChIKey | RHFYPLIBUPAFFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|