About 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one
1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one (PubChem CID 100954291) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one.
Molecular Properties
| Compound Name | 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one |
| PubChem CID | 100954291 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one |
| SMILES | CN1CC2C3C=CC(O)(C(=O)O3)C2C1 |
| InChI | InChI=1S/C10H13NO3/c1-11-4-6-7(5-11)10(13)3-2-8(6)14-9(10)12/h2-3,6-8,13H,4-5H2,1H3 |
| InChIKey | BTMBDKOLDCCUKI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one?
The IUPAC name of 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one (CID 100954291) is 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one.
What is the SMILES notation for 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one?
The canonical SMILES for 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one is CN1CC2C3C=CC(O)(C(=O)O3)C2C1.
What is the InChIKey of 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one?
The InChIKey is BTMBDKOLDCCUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-11-4-6-7(5-11)10(13)3-2-8(6)14-9(10)12/h2-3,6-8,13H,4-5H2,1H3.
What are the key properties of 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one?
1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one has a molecular weight of 195.22 g/mol, XLogP of -0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-en-9-one is sourced from PubChem (CID 100954291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).