C10H9NO5 — CID 85344783
1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 85344783) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 85344783 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-hydroxy-4-methyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | CN1C(=O)C2C3C=CC(O)(C(=O)O3)C2C1=O |
| InChI | InChI=1S/C10H9NO5/c1-11-7(12)5-4-2-3-10(15,9(14)16-4)6(5)8(11)13/h2-6,15H,1H3 |
| InChIKey | NWSNVOIRSFQUQB-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|