C12H17NO4 — CID 10399339
(3aR,4R,5S,7aR)-4-ethoxy-5-hydroxy-2,5-dimethyl-4,7a-dihydro-3aH-isoindole-1,3-dione (PubChem CID 10399339) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (3aR,4R,5S,7aR)-4-ethoxy-5-hydroxy-2,5-dimethyl-4,7a-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,4R,5S,7aR)-4-ethoxy-5-hydroxy-2,5-dimethyl-4,7a-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 10399339 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (3aR,4R,5S,7aR)-4-ethoxy-5-hydroxy-2,5-dimethyl-4,7a-dihydro-3aH-isoindole-1,3-dione |
| SMILES | CCO[C@@H]1[C@@H]2C(=O)N(C)C(=O)[C@@H]2C=C[C@]1(C)O |
| InChI | InChI=1S/C12H17NO4/c1-4-17-9-8-7(5-6-12(9,2)16)10(14)13(3)11(8)15/h5-9,16H,4H2,1-3H3/t7-,8-,9-,12+/m1/s1 |
| InChIKey | LBAIHKVGUWNZOR-HNBLOZHYSA-N |
| XLogP | -0.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|