C14H17NO6 — CID 100954294
(4S)-3-(4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonyl)-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 100954294) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (4S)-3-(4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonyl)-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100954294 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (4S)-3-(4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)C1CC2C=CC1(O)C(=O)O2 |
| InChI | InChI=1S/C14H17NO6/c1-7(2)10-6-20-13(18)15(10)11(16)9-5-8-3-4-14(9,19)12(17)21-8/h3-4,7-10,19H,5-6H2,1-2H3/t8?,9?,10-,14?/m1/s1 |
| InChIKey | WKCDJMAEKIICRW-CLORNOEFSA-N |
| XLogP | 0.22 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|