C15H21NO6 — CID 162417871
prop-2-enyl (1R,4S,6S)-1,4-dihydroxy-6-(morpholine-4-carbonyl)cyclohex-2-ene-1-carboxylate (PubChem CID 162417871) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is prop-2-enyl (1R,4S,6S)-1,4-dihydroxy-6-(morpholine-4-carbonyl)cyclohex-2-ene-1-carboxylate.
| Compound Name | prop-2-enyl (1R,4S,6S)-1,4-dihydroxy-6-(morpholine-4-carbonyl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 162417871 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | prop-2-enyl (1R,4S,6S)-1,4-dihydroxy-6-(morpholine-4-carbonyl)cyclohex-2-ene-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@]1(O)C=C[C@@H](O)C[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H21NO6/c1-2-7-22-14(19)15(20)4-3-11(17)10-12(15)13(18)16-5-8-21-9-6-16/h2-4,11-12,17,20H,1,5-10H2/t11-,12-,15-/m1/s1 |
| InChIKey | POSAFENQRFQZMV-LALPHHSUSA-N |
| XLogP | -0.76 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|