C21H30N2O8 — CID 177442095
tert-butyl N-[2-[(1R,4R,5S,6S)-4-hydroxy-3-oxo-5-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-oxabicyclo[2.2.2]oct-7-en-6-yl]ethyl]carbamate (PubChem CID 177442095) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is tert-butyl N-[2-[(1R,4R,5S,6S)-4-hydroxy-3-oxo-5-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-oxabicyclo[2.2.2]oct-7-en-6-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1R,4R,5S,6S)-4-hydroxy-3-oxo-5-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-oxabicyclo[2.2.2]oct-7-en-6-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 177442095 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | tert-butyl N-[2-[(1R,4R,5S,6S)-4-hydroxy-3-oxo-5-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2-oxabicyclo[2.2.2]oct-7-en-6-yl]ethyl]carbamate |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)[C@H]1[C@H](CCNC(=O)OC(C)(C)C)[C@H]2C=C[C@]1(O)C(=O)O2 |
| InChI | InChI=1S/C21H30N2O8/c1-11(2)13-10-29-19(27)23(13)16(24)15-12(7-9-22-18(26)31-20(3,4)5)14-6-8-21(15,28)17(25)30-14/h6,8,11-15,28H,7,9-10H2,1-5H3,(H,22,26)/t12-,13-,14-,15-,21-/m1/s1 |
| InChIKey | DOHZRZDWQSDMDM-YJKPJRLFSA-N |
| XLogP | 1.36 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|