C10H12OS2 — CID 100954562
O-ethyl cyclohepta-2,4,6-trien-1-ylsulfanylmethanethioate (PubChem CID 100954562) has the molecular formula C10H12OS2 and a molecular weight of 212.34 g/mol. Its IUPAC name is O-ethyl cyclohepta-2,4,6-trien-1-ylsulfanylmethanethioate.
| Compound Name | O-ethyl cyclohepta-2,4,6-trien-1-ylsulfanylmethanethioate |
|---|---|
| PubChem CID | 100954562 |
| Molecular Formula | C10H12OS2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | O-ethyl cyclohepta-2,4,6-trien-1-ylsulfanylmethanethioate |
| SMILES | CCOC(=S)SC1C=CC=CC=C1 |
| InChI | InChI=1S/C10H12OS2/c1-2-11-10(12)13-9-7-5-3-4-6-8-9/h3-9H,2H2,1H3 |
| InChIKey | LQDGRLBZHCVZGI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|