C12H21BrF2O2Si — CID 100955733
[2-bromo-2,2-difluoro-1-(5-methylhexa-1,4-dien-3-yloxy)ethoxy]-trimethylsilane (PubChem CID 100955733) has the molecular formula C12H21BrF2O2Si and a molecular weight of 343.28 g/mol. Its IUPAC name is [2-bromo-2,2-difluoro-1-(5-methylhexa-1,4-dien-3-yloxy)ethoxy]-trimethylsilane.
| Compound Name | [2-bromo-2,2-difluoro-1-(5-methylhexa-1,4-dien-3-yloxy)ethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 100955733 |
| Molecular Formula | C12H21BrF2O2Si |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [2-bromo-2,2-difluoro-1-(5-methylhexa-1,4-dien-3-yloxy)ethoxy]-trimethylsilane |
| SMILES | C=CC(C=C(C)C)OC(O[Si](C)(C)C)C(F)(F)Br |
| InChI | InChI=1S/C12H21BrF2O2Si/c1-7-10(8-9(2)3)16-11(12(13,14)15)17-18(4,5)6/h7-8,10-11H,1H2,2-6H3 |
| InChIKey | VCJBNFKFIHINNO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|