About [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane
[2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane (PubChem CID 10567471) has the molecular formula C10H19BrF2O2Si
and a molecular weight of 317.25 g/mol. Its IUPAC name is [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane |
| PubChem CID | 10567471 |
| Molecular Formula | C10H19BrF2O2Si |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane |
| SMILES | CC(C)=CCOC(O[Si](C)(C)C)C(F)(F)Br |
| InChI | InChI=1S/C10H19BrF2O2Si/c1-8(2)6-7-14-9(10(11,12)13)15-16(3,4)5/h6,9H,7H2,1-5H3 |
| InChIKey | ICDQPWHVHUHTAB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane?
The IUPAC name of [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane (CID 10567471) is [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane.
What is the SMILES notation for [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane?
The canonical SMILES for [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane is CC(C)=CCOC(O[Si](C)(C)C)C(F)(F)Br.
What is the InChIKey of [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane?
The InChIKey is ICDQPWHVHUHTAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BrF2O2Si/c1-8(2)6-7-14-9(10(11,12)13)15-16(3,4)5/h6,9H,7H2,1-5H3.
What are the key properties of [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane?
[2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane has a molecular weight of 317.25 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-2,2-difluoro-1-(3-methylbut-2-enoxy)ethoxy]-trimethylsilane is sourced from PubChem (CID 10567471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).