About (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane
(2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane (PubChem CID 15205535) has the molecular formula C8H15BrF2O2Si
and a molecular weight of 289.19 g/mol. Its IUPAC name is (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane.
Molecular Properties
| Compound Name | (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane |
| PubChem CID | 15205535 |
| Molecular Formula | C8H15BrF2O2Si |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane |
| SMILES | C=CCOC(O[Si](C)(C)C)C(F)(F)Br |
| InChI | InChI=1S/C8H15BrF2O2Si/c1-5-6-12-7(8(9,10)11)13-14(2,3)4/h5,7H,1,6H2,2-4H3 |
| InChIKey | NDUWHACFXUDZGO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane?
The IUPAC name of (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane (CID 15205535) is (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane.
What is the SMILES notation for (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane?
The canonical SMILES for (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane is C=CCOC(O[Si](C)(C)C)C(F)(F)Br.
What is the InChIKey of (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane?
The InChIKey is NDUWHACFXUDZGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrF2O2Si/c1-5-6-12-7(8(9,10)11)13-14(2,3)4/h5,7H,1,6H2,2-4H3.
What are the key properties of (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane?
(2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane has a molecular weight of 289.19 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-2,2-difluoro-1-prop-2-enoxyethoxy)-trimethylsilane is sourced from PubChem (CID 15205535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).