C29H39NO4S — CID 100955917
ethyl (3S,4R)-4-(benzenesulfonyl)-5-[[[(1S)-1-cyclohexylethyl]amino]methyl]-3-phenylhex-5-enoate (PubChem CID 100955917) has the molecular formula C29H39NO4S and a molecular weight of 497.70 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(benzenesulfonyl)-5-[[[(1S)-1-cyclohexylethyl]amino]methyl]-3-phenylhex-5-enoate.
| Compound Name | ethyl (3S,4R)-4-(benzenesulfonyl)-5-[[[(1S)-1-cyclohexylethyl]amino]methyl]-3-phenylhex-5-enoate |
|---|---|
| PubChem CID | 100955917 |
| Molecular Formula | C29H39NO4S |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | ethyl (3S,4R)-4-(benzenesulfonyl)-5-[[[(1S)-1-cyclohexylethyl]amino]methyl]-3-phenylhex-5-enoate |
| SMILES | C=C(CN[C@@H](C)C1CCCCC1)[C@@H]([C@@H](CC(=O)OCC)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H39NO4S/c1-4-34-28(31)20-27(25-16-10-6-11-17-25)29(35(32,33)26-18-12-7-13-19-26)22(2)21-30-23(3)24-14-8-5-9-15-24/h6-7,10-13,16-19,23-24,27,29-30H,2,4-5,8-9,14-15,20-21H2,1,3H3/t23-,27-,29-/m0/s1 |
| InChIKey | IQGMERWJGDDMQM-HTZJHERLSA-N |
| XLogP | 5.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|