C24H31NO2 — CID 102531001
ethyl (3S)-3-(benzhydrylamino)-3-cyclohexylpropanoate (PubChem CID 102531001) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is ethyl (3S)-3-(benzhydrylamino)-3-cyclohexylpropanoate.
| Compound Name | ethyl (3S)-3-(benzhydrylamino)-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 102531001 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | ethyl (3S)-3-(benzhydrylamino)-3-cyclohexylpropanoate |
| SMILES | CCOC(=O)C[C@H](NC(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H31NO2/c1-2-27-23(26)18-22(19-12-6-3-7-13-19)25-24(20-14-8-4-9-15-20)21-16-10-5-11-17-21/h4-5,8-11,14-17,19,22,24-25H,2-3,6-7,12-13,18H2,1H3/t22-/m0/s1 |
| InChIKey | LIADHOKPVABBFU-QFIPXVFZSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |