C11H20O — CID 100956018
(2R,3S)-2-ethenyl-3-heptyloxirane (PubChem CID 100956018) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2R,3S)-2-ethenyl-3-heptyloxirane.
| Compound Name | (2R,3S)-2-ethenyl-3-heptyloxirane |
|---|---|
| PubChem CID | 100956018 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2R,3S)-2-ethenyl-3-heptyloxirane |
| SMILES | C=C[C@H]1O[C@H]1CCCCCCC |
| InChI | InChI=1S/C11H20O/c1-3-5-6-7-8-9-11-10(4-2)12-11/h4,10-11H,2-3,5-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | AFJNBWVDBYUPQJ-MNOVXSKESA-N |
| XLogP | 3.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|