C14H28O — CID 100956232
3-tert-butyl-4-ethyl-2,2-dimethylhex-5-en-3-ol (PubChem CID 100956232) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-tert-butyl-4-ethyl-2,2-dimethylhex-5-en-3-ol.
| Compound Name | 3-tert-butyl-4-ethyl-2,2-dimethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 100956232 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 3-tert-butyl-4-ethyl-2,2-dimethylhex-5-en-3-ol |
| SMILES | C=CC(CC)C(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-9-11(10-2)14(15,12(3,4)5)13(6,7)8/h9,11,15H,1,10H2,2-8H3 |
| InChIKey | DPRFTBPOHURWSI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|