About 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one
4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one (PubChem CID 100956325) has the molecular formula C7H10ClNO2
and a molecular weight of 175.61 g/mol. Its IUPAC name is 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one |
| PubChem CID | 100956325 |
| Molecular Formula | C7H10ClNO2 |
| Molecular Weight | 175.61 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one |
| SMILES | C=CCCC1COC(=O)N1Cl |
| InChI | InChI=1S/C7H10ClNO2/c1-2-3-4-6-5-11-7(10)9(6)8/h2,6H,1,3-5H2 |
| InChIKey | UPMTUIIOJFKPMX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one?
The IUPAC name of 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one (CID 100956325) is 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one?
The canonical SMILES for 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one is C=CCCC1COC(=O)N1Cl.
What is the InChIKey of 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one?
The InChIKey is UPMTUIIOJFKPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNO2/c1-2-3-4-6-5-11-7(10)9(6)8/h2,6H,1,3-5H2.
What are the key properties of 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one?
4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one has a molecular weight of 175.61 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-3-chloro-1,3-oxazolidin-2-one is sourced from PubChem (CID 100956325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).