C29H31NO4 — CID 10095633
2-[[6-[(2E)-2-benzhydryloxyiminobutyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 10095633) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[[6-[(2E)-2-benzhydryloxyiminobutyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[(2E)-2-benzhydryloxyiminobutyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 10095633 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-[[6-[(2E)-2-benzhydryloxyiminobutyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | CC/C(CC1CCc2c(cccc2OCC(=O)O)C1)=N\OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO4/c1-2-25(30-34-29(22-10-5-3-6-11-22)23-12-7-4-8-13-23)19-21-16-17-26-24(18-21)14-9-15-27(26)33-20-28(31)32/h3-15,21,29H,2,16-20H2,1H3,(H,31,32)/b30-25+ |
| InChIKey | TWFCJHGHTJJDOC-QCWLDUFUSA-N |
| XLogP | 6.22 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|