C12H9Cl2F3O2S — CID 100956820
(4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-(trifluoromethyl)oxolan-2-one (PubChem CID 100956820) has the molecular formula C12H9Cl2F3O2S and a molecular weight of 345.17 g/mol. Its IUPAC name is (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-(trifluoromethyl)oxolan-2-one.
| Compound Name | (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 100956820 |
| Molecular Formula | C12H9Cl2F3O2S |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | (4S,5R)-3,3-dichloro-5-(4-methylphenyl)sulfanyl-4-(trifluoromethyl)oxolan-2-one |
| SMILES | Cc1ccc(S[C@H]2OC(=O)C(Cl)(Cl)[C@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9Cl2F3O2S/c1-6-2-4-7(5-3-6)20-9-8(12(15,16)17)11(13,14)10(18)19-9/h2-5,8-9H,1H3/t8-,9+/m0/s1 |
| InChIKey | ADSCEEBSNXGSDZ-DTWKUNHWSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|