C13H12Cl2F2O2S — CID 100956821
(4S,5R)-3,3-dichloro-4-(1,1-difluoroethyl)-5-(4-methylphenyl)sulfanyloxolan-2-one (PubChem CID 100956821) has the molecular formula C13H12Cl2F2O2S and a molecular weight of 341.21 g/mol. Its IUPAC name is (4S,5R)-3,3-dichloro-4-(1,1-difluoroethyl)-5-(4-methylphenyl)sulfanyloxolan-2-one.
| Compound Name | (4S,5R)-3,3-dichloro-4-(1,1-difluoroethyl)-5-(4-methylphenyl)sulfanyloxolan-2-one |
|---|---|
| PubChem CID | 100956821 |
| Molecular Formula | C13H12Cl2F2O2S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (4S,5R)-3,3-dichloro-4-(1,1-difluoroethyl)-5-(4-methylphenyl)sulfanyloxolan-2-one |
| SMILES | Cc1ccc(S[C@H]2OC(=O)C(Cl)(Cl)[C@H]2C(C)(F)F)cc1 |
| InChI | InChI=1S/C13H12Cl2F2O2S/c1-7-3-5-8(6-4-7)20-10-9(12(2,16)17)13(14,15)11(18)19-10/h3-6,9-10H,1-2H3/t9-,10-/m1/s1 |
| InChIKey | IMHDUWMZJZFJGW-NXEZZACHSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|