C15H17F3O6S — CID 100958701
ethyl 4,7,7-trimethyl-8-oxo-6-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2-carboxylate (PubChem CID 100958701) has the molecular formula C15H17F3O6S and a molecular weight of 382.36 g/mol. Its IUPAC name is ethyl 4,7,7-trimethyl-8-oxo-6-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2-carboxylate.
| Compound Name | ethyl 4,7,7-trimethyl-8-oxo-6-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 100958701 |
| Molecular Formula | C15H17F3O6S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 4,7,7-trimethyl-8-oxo-6-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC2(C)C=C(OS(=O)(=O)C(F)(F)F)C1C(C)(C)C2=O |
| InChI | InChI=1S/C15H17F3O6S/c1-5-23-11(19)8-6-14(4)7-9(10(8)13(2,3)12(14)20)24-25(21,22)15(16,17)18/h6-7,10H,5H2,1-4H3 |
| InChIKey | QXAGZVZMGAUQKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|