C16H17F3O8S — CID 100958699
dimethyl 1,8,8-trimethyl-7-oxo-5-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate (PubChem CID 100958699) has the molecular formula C16H17F3O8S and a molecular weight of 426.37 g/mol. Its IUPAC name is dimethyl 1,8,8-trimethyl-7-oxo-5-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,8,8-trimethyl-7-oxo-5-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 100958699 |
| Molecular Formula | C16H17F3O8S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | dimethyl 1,8,8-trimethyl-7-oxo-5-(trifluoromethylsulfonyloxy)bicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)C=C(OS(=O)(=O)C(F)(F)F)C1C(C)(C)C2=O |
| InChI | InChI=1S/C16H17F3O8S/c1-14(2)9-7(27-28(23,24)16(17,18)19)6-15(3,13(14)22)10(12(21)26-5)8(9)11(20)25-4/h6,9H,1-5H3 |
| InChIKey | KYVHDXYQACQAIA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|