C17H20O7 — CID 134878011
dimethyl 5-acetyloxy-1,8,8-trimethyl-7-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate (PubChem CID 134878011) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is dimethyl 5-acetyloxy-1,8,8-trimethyl-7-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 5-acetyloxy-1,8,8-trimethyl-7-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134878011 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | dimethyl 5-acetyloxy-1,8,8-trimethyl-7-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)C=C(OC(C)=O)C1C(C)(C)C2=O |
| InChI | InChI=1S/C17H20O7/c1-8(18)24-9-7-17(4)12(14(20)23-6)10(13(19)22-5)11(9)16(2,3)15(17)21/h7,11H,1-6H3 |
| InChIKey | NZAWEPZKKRMIQE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|