C20H18O6 — CID 134864918
(1R,2R,9R,17R)-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-5,7,13-triene-3,4,11,15,16-pentone (PubChem CID 134864918) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (1R,2R,9R,17R)-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-5,7,13-triene-3,4,11,15,16-pentone.
| Compound Name | (1R,2R,9R,17R)-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-5,7,13-triene-3,4,11,15,16-pentone |
|---|---|
| PubChem CID | 134864918 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (1R,2R,9R,17R)-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-5,7,13-triene-3,4,11,15,16-pentone |
| SMILES | CC1=CC(=O)C(=O)[C@@]2(C)C1=C[C@H]1OC(=O)CC3=C(C)C(=O)C(=O)[C@@H]2[C@]31C |
| InChI | InChI=1S/C20H18O6/c1-8-5-12(21)18(25)20(4)10(8)6-13-19(3)11(7-14(22)26-13)9(2)15(23)16(24)17(19)20/h5-6,13,17H,7H2,1-4H3/t13-,17-,19-,20+/m1/s1 |
| InChIKey | AEBQRSDRDGLHNQ-HSGBFHSBSA-N |
| XLogP | 1.44 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|