C22H30O5 — CID 155514899
methyl (4aR,10aS)-9-methoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate (PubChem CID 155514899) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (4aR,10aS)-9-methoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate.
| Compound Name | methyl (4aR,10aS)-9-methoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate |
|---|---|
| PubChem CID | 155514899 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (4aR,10aS)-9-methoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCC(C)(C)[C@@H]1CC(OC)C1=C2C(=O)C(=O)C(C(C)C)=C1 |
| InChI | InChI=1S/C22H30O5/c1-12(2)13-10-14-15(26-5)11-16-21(3,4)8-7-9-22(16,20(25)27-6)17(14)19(24)18(13)23/h10,12,15-16H,7-9,11H2,1-6H3/t15?,16-,22+/m0/s1 |
| InChIKey | KFJHKHSLKPWOCY-MWVIVRMESA-N |
| XLogP | 3.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|