C24H23NS2 — CID 100959775
(1R,9R)-4,12-dimethyl-17-(2-phenylethyl)-8,16-dithia-17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 100959775) has the molecular formula C24H23NS2 and a molecular weight of 389.59 g/mol. Its IUPAC name is (1R,9R)-4,12-dimethyl-17-(2-phenylethyl)-8,16-dithia-17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | (1R,9R)-4,12-dimethyl-17-(2-phenylethyl)-8,16-dithia-17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 100959775 |
| Molecular Formula | C24H23NS2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (1R,9R)-4,12-dimethyl-17-(2-phenylethyl)-8,16-dithia-17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Cc1ccc2c(c1)[C@H]1Sc3ccc(C)cc3[C@@H](S2)N1CCc1ccccc1 |
| InChI | InChI=1S/C24H23NS2/c1-16-8-10-21-19(14-16)23-25(13-12-18-6-4-3-5-7-18)24(26-21)20-15-17(2)9-11-22(20)27-23/h3-11,14-15,23-24H,12-13H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | ZPCKFZQYMWAAHB-DNQXCXABSA-N |
| XLogP | 6.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |