About trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate
trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate (PubChem CID 100961623) has the molecular formula C5H10O3
and a molecular weight of 124.17 g/mol. Its IUPAC name is trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate.
Molecular Properties
| Compound Name | trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate |
| PubChem CID | 100961623 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate |
| SMILES | [2H]C([2H])([2H])OC(=O)[C@H](C)OC([2H])([2H])[2H] |
| InChI | InChI=1S/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3/t4-/m0/s1/i2D3,3D3 |
| InChIKey | VABBJJOSOCPYIT-QDWNJDLHSA-N |
| XLogP | 0.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate?
The IUPAC name of trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate (CID 100961623) is trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate.
What is the SMILES notation for trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate?
The canonical SMILES for trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate is [2H]C([2H])([2H])OC(=O)[C@H](C)OC([2H])([2H])[2H].
What is the InChIKey of trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate?
The InChIKey is VABBJJOSOCPYIT-QDWNJDLHSA-N. The full InChI is InChI=1S/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3/t4-/m0/s1/i2D3,3D3.
What are the key properties of trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate?
trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate has a molecular weight of 124.17 g/mol, XLogP of 0.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trideuteriomethyl (2S)-2-(trideuteriomethoxy)propanoate is sourced from PubChem (CID 100961623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).