C41H45I2N3O2 — CID 100962748
2,6-bis[5-[3-(hexoxymethyl)-5-iodophenyl]-2-pyridinyl]pyridine (PubChem CID 100962748) has the molecular formula C41H45I2N3O2 and a molecular weight of 865.64 g/mol. Its IUPAC name is 2,6-bis[5-[3-(hexoxymethyl)-5-iodophenyl]-2-pyridinyl]pyridine.
| Compound Name | 2,6-bis[5-[3-(hexoxymethyl)-5-iodophenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 100962748 |
| Molecular Formula | C41H45I2N3O2 |
| Molecular Weight | 865.64 g/mol |
| Exact Mass | 865.16 |
| IUPAC Name | 2,6-bis[5-[3-(hexoxymethyl)-5-iodophenyl]-2-pyridinyl]pyridine |
| SMILES | CCCCCCOCc1cc(I)cc(-c2ccc(-c3cccc(-c4ccc(-c5cc(I)cc(COCCCCCC)c5)cn4)n3)nc2)c1 |
| InChI | InChI=1S/C41H45I2N3O2/c1-3-5-7-9-18-47-28-30-20-34(24-36(42)22-30)32-14-16-38(44-26-32)40-12-11-13-41(46-40)39-17-15-33(27-45-39)35-21-31(23-37(43)25-35)29-48-19-10-8-6-4-2/h11-17,20-27H,3-10,18-19,28-29H2,1-2H3 |
| InChIKey | DLDUXOPONGTTMJ-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.64 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|