C28H25FN4O — CID 177181103
[2-(6-pyridin-2-yl-3-pyridinyl)ethanimidoyl] 5-fluoro-2-(2-propan-2-ylphenyl)benzenecarboximidate (PubChem CID 177181103) has the molecular formula C28H25FN4O and a molecular weight of 452.53 g/mol. Its IUPAC name is [2-(6-pyridin-2-yl-3-pyridinyl)ethanimidoyl] 5-fluoro-2-(2-propan-2-ylphenyl)benzenecarboximidate.
| Compound Name | [2-(6-pyridin-2-yl-3-pyridinyl)ethanimidoyl] 5-fluoro-2-(2-propan-2-ylphenyl)benzenecarboximidate |
|---|---|
| PubChem CID | 177181103 |
| Molecular Formula | C28H25FN4O |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [2-(6-pyridin-2-yl-3-pyridinyl)ethanimidoyl] 5-fluoro-2-(2-propan-2-ylphenyl)benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(Cc1ccc(-c2ccccn2)nc1)=N/[H])c1cc(F)ccc1-c1ccccc1C(C)C |
| InChI | InChI=1S/C28H25FN4O/c1-18(2)21-7-3-4-8-22(21)23-12-11-20(29)16-24(23)28(31)34-27(30)15-19-10-13-26(33-17-19)25-9-5-6-14-32-25/h3-14,16-18,30-31H,15H2,1-2H3/b30-27+,31-28- |
| InChIKey | DNIJJIZZSDASAJ-UCOKIVQFSA-N |
| XLogP | 6.64 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|