C30H27F5N2O — CID 162398338
3-[4-(2-ethylhexoxy)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine (PubChem CID 162398338) has the molecular formula C30H27F5N2O and a molecular weight of 526.55 g/mol. Its IUPAC name is 3-[4-(2-ethylhexoxy)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine.
| Compound Name | 3-[4-(2-ethylhexoxy)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162398338 |
| Molecular Formula | C30H27F5N2O |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 3-[4-(2-ethylhexoxy)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc(-c3ccccn3)nc2-c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H27F5N2O/c1-3-5-8-18(4-2)17-38-20-12-10-19(11-13-20)21-14-15-23(22-9-6-7-16-36-22)37-30(21)24-25(31)27(33)29(35)28(34)26(24)32/h6-7,9-16,18H,3-5,8,17H2,1-2H3 |
| InChIKey | LKJPPRJPCUDVFI-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|