C28H37N3O4S — CID 100963953
methyl (2S)-2-[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanethioyl]amino]propylamino]-3-methylpentanoate (PubChem CID 100963953) has the molecular formula C28H37N3O4S and a molecular weight of 511.69 g/mol. Its IUPAC name is methyl (2S)-2-[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanethioyl]amino]propylamino]-3-methylpentanoate.
| Compound Name | methyl (2S)-2-[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanethioyl]amino]propylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 100963953 |
| Molecular Formula | C28H37N3O4S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | methyl (2S)-2-[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanethioyl]amino]propylamino]-3-methylpentanoate |
| SMILES | CCC(C)[C@H](NCC(C)NC(=S)[C@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C28H37N3O4S/c1-6-17(2)25(27(32)34-5)29-15-18(3)30-26(36)19(4)31-28(33)35-16-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,17-19,24-25,29H,6,15-16H2,1-5H3,(H,30,36)(H,31,33)/t17?,18?,19-,25-/m0/s1 |
| InChIKey | JWBBSNPGLZNRAZ-XZYMBRPJSA-N |
| XLogP | 4.40 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|