C20H28O5Si — CID 100964169
6-[(2R,3S,6S)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]hex-5-ynyl acetate (PubChem CID 100964169) has the molecular formula C20H28O5Si and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-[(2R,3S,6S)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]hex-5-ynyl acetate.
| Compound Name | 6-[(2R,3S,6S)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]hex-5-ynyl acetate |
|---|---|
| PubChem CID | 100964169 |
| Molecular Formula | C20H28O5Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-[(2R,3S,6S)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]hex-5-ynyl acetate |
| SMILES | CC(=O)OCCCCC#C[C@H]1O[C@H](C#C[Si](C)(C)C)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H28O5Si/c1-16(21)23-14-9-7-6-8-10-19-20(24-17(2)22)12-11-18(25-19)13-15-26(3,4)5/h11-12,18-20H,6-7,9,14H2,1-5H3/t18-,19+,20-/m0/s1 |
| InChIKey | KCKMDJAPGOYZSP-ZCNNSNEGSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|