C12H18O3Si — CID 11333889
[(3S,6R)-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 11333889) has the molecular formula C12H18O3Si and a molecular weight of 238.36 g/mol. Its IUPAC name is [(3S,6R)-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6R)-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 11333889 |
| Molecular Formula | C12H18O3Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(3S,6R)-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](C#C[Si](C)(C)C)OC1 |
| InChI | InChI=1S/C12H18O3Si/c1-10(13)15-12-6-5-11(14-9-12)7-8-16(2,3)4/h5-6,11-12H,9H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | DNHDXQLREQGMAW-NEPJUHHUSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|