C15H22O5Si — CID 134901154
[(2S,3R)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134901154) has the molecular formula C15H22O5Si and a molecular weight of 310.42 g/mol. Its IUPAC name is [(2S,3R)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3R)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134901154 |
| Molecular Formula | C15H22O5Si |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [(2S,3R)-3-acetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(C#C[Si](C)(C)C)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O5Si/c1-11(16)18-10-15-14(19-12(2)17)7-6-13(20-15)8-9-21(3,4)5/h6-7,13-15H,10H2,1-5H3/t13?,14-,15+/m1/s1 |
| InChIKey | SIRKJZATISCRQO-DMJDIKPUSA-N |
| XLogP | 1.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|