C16H22O5 — CID 16758836
[3-acetyloxy-6-(3,3-dimethylbut-1-ynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 16758836) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [3-acetyloxy-6-(3,3-dimethylbut-1-ynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-(3,3-dimethylbut-1-ynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16758836 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [3-acetyloxy-6-(3,3-dimethylbut-1-ynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(C#CC(C)(C)C)C=CC1OC(C)=O |
| InChI | InChI=1S/C16H22O5/c1-11(17)19-10-15-14(20-12(2)18)7-6-13(21-15)8-9-16(3,4)5/h6-7,13-15H,10H2,1-5H3 |
| InChIKey | OVHXIQPFJRNNRC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|