C10H18O3Si — CID 100965124
methyl 2,2,5,6-tetramethyl-3,6-dihydrooxasiline-3-carboxylate (PubChem CID 100965124) has the molecular formula C10H18O3Si and a molecular weight of 214.34 g/mol. Its IUPAC name is methyl 2,2,5,6-tetramethyl-3,6-dihydrooxasiline-3-carboxylate.
| Compound Name | methyl 2,2,5,6-tetramethyl-3,6-dihydrooxasiline-3-carboxylate |
|---|---|
| PubChem CID | 100965124 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | methyl 2,2,5,6-tetramethyl-3,6-dihydrooxasiline-3-carboxylate |
| SMILES | COC(=O)C1C=C(C)C(C)O[Si]1(C)C |
| InChI | InChI=1S/C10H18O3Si/c1-7-6-9(10(11)12-3)14(4,5)13-8(7)2/h6,8-9H,1-5H3 |
| InChIKey | LPADBMMINAXTEL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|