About methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate
methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate (PubChem CID 100965126) has the molecular formula C14H26O4Si
and a molecular weight of 286.44 g/mol. Its IUPAC name is methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate |
| PubChem CID | 100965126 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate |
| SMILES | COC(=O)C1CC(C)(C(C)=O)O[Si]1(C(C)C)C(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-9(2)19(10(3)4)12(13(16)17-7)8-14(6,18-19)11(5)15/h9-10,12H,8H2,1-7H3 |
| InChIKey | CMTGRZGRGBNRMU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The IUPAC name of methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate (CID 100965126) is methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate.
What is the SMILES notation for methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The canonical SMILES for methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate is COC(=O)C1CC(C)(C(C)=O)O[Si]1(C(C)C)C(C)C.
What is the InChIKey of methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The InChIKey is CMTGRZGRGBNRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4Si/c1-9(2)19(10(3)4)12(13(16)17-7)8-14(6,18-19)11(5)15/h9-10,12H,8H2,1-7H3.
What are the key properties of methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate has a molecular weight of 286.44 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyl-5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate is sourced from PubChem (CID 100965126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).