C15H30O4Si — CID 10870388
methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-5-oxohexanoate (PubChem CID 10870388) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-5-oxohexanoate.
| Compound Name | methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-5-oxohexanoate |
|---|---|
| PubChem CID | 10870388 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-5-oxohexanoate |
| SMILES | COC(=O)[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H](C)CC(C)=O |
| InChI | InChI=1S/C15H30O4Si/c1-11(10-12(2)16)15(6,13(17)18-7)19-20(8,9)14(3,4)5/h11H,10H2,1-9H3/t11-,15-/m1/s1 |
| InChIKey | ZVCZWBZIJFRGNF-IAQYHMDHSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|