C18H30O2 — CID 100965923
(4S,6S)-2-[(E)-dodec-1-en-6-ynyl]-4,6-dimethyl-1,3-dioxane (PubChem CID 100965923) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (4S,6S)-2-[(E)-dodec-1-en-6-ynyl]-4,6-dimethyl-1,3-dioxane.
| Compound Name | (4S,6S)-2-[(E)-dodec-1-en-6-ynyl]-4,6-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 100965923 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (4S,6S)-2-[(E)-dodec-1-en-6-ynyl]-4,6-dimethyl-1,3-dioxane |
| SMILES | CCCCCC#CCCC/C=C/C1O[C@@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C18H30O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-19-16(2)15-17(3)20-18/h13-14,16-18H,4-7,10-12,15H2,1-3H3/b14-13+/t16-,17-/m0/s1 |
| InChIKey | WWSYBPAXKDOKRU-GAEQQSHZSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|