C22H38O2 — CID 100965924
(4R,6R)-2-[(E)-dodec-1-en-6-ynyl]-4,6-di(propan-2-yl)-1,3-dioxane (PubChem CID 100965924) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (4R,6R)-2-[(E)-dodec-1-en-6-ynyl]-4,6-di(propan-2-yl)-1,3-dioxane.
| Compound Name | (4R,6R)-2-[(E)-dodec-1-en-6-ynyl]-4,6-di(propan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 100965924 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (4R,6R)-2-[(E)-dodec-1-en-6-ynyl]-4,6-di(propan-2-yl)-1,3-dioxane |
| SMILES | CCCCCC#CCCC/C=C/C1O[C@@H](C(C)C)C[C@H](C(C)C)O1 |
| InChI | InChI=1S/C22H38O2/c1-6-7-8-9-10-11-12-13-14-15-16-22-23-20(18(2)3)17-21(24-22)19(4)5/h15-16,18-22H,6-9,12-14,17H2,1-5H3/b16-15+/t20-,21-/m1/s1 |
| InChIKey | WYZHLOGHDOCSNM-IFTVWREOSA-N |
| XLogP | 6.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|