C16H18N2O2 — CID 100967240
3-but-3-enyl-1-methyl-5-phenylmethoxypyrazole-4-carbaldehyde (PubChem CID 100967240) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-but-3-enyl-1-methyl-5-phenylmethoxypyrazole-4-carbaldehyde.
| Compound Name | 3-but-3-enyl-1-methyl-5-phenylmethoxypyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 100967240 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-but-3-enyl-1-methyl-5-phenylmethoxypyrazole-4-carbaldehyde |
| SMILES | C=CCCc1nn(C)c(OCc2ccccc2)c1C=O |
| InChI | InChI=1S/C16H18N2O2/c1-3-4-10-15-14(11-19)16(18(2)17-15)20-12-13-8-6-5-7-9-13/h3,5-9,11H,1,4,10,12H2,2H3 |
| InChIKey | FVZNMQQPWGWPPD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|