C19H28IN3O3 — CID 29630
2-(1-benzyl-4-ethoxycarbonyl-3-methylpyrazol-5-yl)oxyethyl-trimethylazanium iodide (PubChem CID 29630) has the molecular formula C19H28IN3O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-(1-benzyl-4-ethoxycarbonyl-3-methylpyrazol-5-yl)oxyethyl-trimethylazanium iodide.
| Compound Name | 2-(1-benzyl-4-ethoxycarbonyl-3-methylpyrazol-5-yl)oxyethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 29630 |
| Molecular Formula | C19H28IN3O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-(1-benzyl-4-ethoxycarbonyl-3-methylpyrazol-5-yl)oxyethyl-trimethylazanium iodide |
| SMILES | CCOC(=O)c1c(C)nn(Cc2ccccc2)c1OCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C19H28N3O3.HI/c1-6-24-19(23)17-15(2)20-21(14-16-10-8-7-9-11-16)18(17)25-13-12-22(3,4)5;/h7-11H,6,12-14H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | PAKVLLSBOBUJQO-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|