C8H6FN3O4S3 — CID 100967613
5-(4-fluorophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 100967613) has the molecular formula C8H6FN3O4S3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 100967613 |
| Molecular Formula | C8H6FN3O4S3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(S(=O)(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C8H6FN3O4S3/c9-5-1-3-6(4-2-5)18(13,14)7-11-12-8(17-7)19(10,15)16/h1-4H,(H2,10,15,16) |
| InChIKey | QBOJEMSGPHCMFQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |