C13H19F3O5S — CID 100968134
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(trifluoromethylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100968134) has the molecular formula C13H19F3O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(trifluoromethylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(trifluoromethylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100968134 |
| Molecular Formula | C13H19F3O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(trifluoromethylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CSC(F)(F)F)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H19F3O5S/c1-11(2)18-7-6(5-22-13(14,15)16)17-10-9(8(7)19-11)20-12(3,4)21-10/h6-10H,5H2,1-4H3/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | KUBWYVKECAIBHH-SOYHJAILSA-N |
| XLogP | 2.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |