C13H22O5S — CID 135033228
(1S,6R,9R)-4,4,11,11-tetramethyl-8-(methylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 135033228) has the molecular formula C13H22O5S and a molecular weight of 290.38 g/mol. Its IUPAC name is (1S,6R,9R)-4,4,11,11-tetramethyl-8-(methylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,6R,9R)-4,4,11,11-tetramethyl-8-(methylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 135033228 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (1S,6R,9R)-4,4,11,11-tetramethyl-8-(methylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CSCC1O[C@@H]2OC(C)(C)OC2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H22O5S/c1-12(2)15-8-7(6-19-5)14-11-10(9(8)16-12)17-13(3,4)18-11/h7-11H,6H2,1-5H3/t7?,8-,9-,10?,11+/m0/s1 |
| InChIKey | OXGXJLVSCVCZSE-RIKJVJJSSA-N |
| XLogP | 1.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |