C20H34O2Si2 — CID 100968418
5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-trimethylsilyl-2,3-dihydroinden-1-one (PubChem CID 100968418) has the molecular formula C20H34O2Si2 and a molecular weight of 362.66 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-trimethylsilyl-2,3-dihydroinden-1-one.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-trimethylsilyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 100968418 |
| Molecular Formula | C20H34O2Si2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-trimethylsilyl-2,3-dihydroinden-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cc2c(c([Si](C)(C)C)c1)C(=O)CC2 |
| InChI | InChI=1S/C20H34O2Si2/c1-20(2,3)24(7,8)22-12-11-15-13-16-9-10-17(21)19(16)18(14-15)23(4,5)6/h13-14H,9-12H2,1-8H3 |
| InChIKey | YQLHGUIHIUSMRU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|