C21H34O2Si — CID 100968423
7-tert-butyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroinden-1-one (PubChem CID 100968423) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is 7-tert-butyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroinden-1-one.
| Compound Name | 7-tert-butyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 100968423 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 7-tert-butyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroinden-1-one |
| SMILES | CC(C)(C)c1cc(CCO[Si](C)(C)C(C)(C)C)cc2c1C(=O)CC2 |
| InChI | InChI=1S/C21H34O2Si/c1-20(2,3)17-14-15(13-16-9-10-18(22)19(16)17)11-12-23-24(7,8)21(4,5)6/h13-14H,9-12H2,1-8H3 |
| InChIKey | MQESPIUYMKJFBR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|