C18H28O3 — CID 100969648
ethyl (3aS,6R,6aS)-6a-hex-1-ynyl-6-hydroxy-6-methyl-2,3,4,5-tetrahydro-1H-pentalene-3a-carboxylate (PubChem CID 100969648) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethyl (3aS,6R,6aS)-6a-hex-1-ynyl-6-hydroxy-6-methyl-2,3,4,5-tetrahydro-1H-pentalene-3a-carboxylate.
| Compound Name | ethyl (3aS,6R,6aS)-6a-hex-1-ynyl-6-hydroxy-6-methyl-2,3,4,5-tetrahydro-1H-pentalene-3a-carboxylate |
|---|---|
| PubChem CID | 100969648 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | ethyl (3aS,6R,6aS)-6a-hex-1-ynyl-6-hydroxy-6-methyl-2,3,4,5-tetrahydro-1H-pentalene-3a-carboxylate |
| SMILES | CCCCC#C[C@@]12CCC[C@]1(C(=O)OCC)CC[C@@]2(C)O |
| InChI | InChI=1S/C18H28O3/c1-4-6-7-8-11-18-12-9-10-17(18,15(19)21-5-2)14-13-16(18,3)20/h20H,4-7,9-10,12-14H2,1-3H3/t16-,17-,18+/m1/s1 |
| InChIKey | YMIKVVSHSWUKGQ-KURKYZTESA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|