C25H21F5N4O — CID 10096994
N-[2-[1-[4-(2-cyano-5-methylphenyl)phenyl]ethylamino]-4-methyl-3-pyridinyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 10096994) has the molecular formula C25H21F5N4O and a molecular weight of 488.46 g/mol. Its IUPAC name is N-[2-[1-[4-(2-cyano-5-methylphenyl)phenyl]ethylamino]-4-methyl-3-pyridinyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[2-[1-[4-(2-cyano-5-methylphenyl)phenyl]ethylamino]-4-methyl-3-pyridinyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 10096994 |
| Molecular Formula | C25H21F5N4O |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[2-[1-[4-(2-cyano-5-methylphenyl)phenyl]ethylamino]-4-methyl-3-pyridinyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | Cc1ccc(C#N)c(-c2ccc(C(C)Nc3nccc(C)c3NC(=O)C(F)(F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H21F5N4O/c1-14-4-5-19(13-31)20(12-14)18-8-6-17(7-9-18)16(3)33-22-21(15(2)10-11-32-22)34-23(35)24(26,27)25(28,29)30/h4-12,16H,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | KIXYLKIKMHAFHP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|