C23H16ClF6N3O3 — CID 10324760
2-[4-[1-[[4-chloro-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]ethyl]phenyl]-4-fluorobenzoic acid (PubChem CID 10324760) has the molecular formula C23H16ClF6N3O3 and a molecular weight of 531.84 g/mol. Its IUPAC name is 2-[4-[1-[[4-chloro-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]ethyl]phenyl]-4-fluorobenzoic acid.
| Compound Name | 2-[4-[1-[[4-chloro-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]ethyl]phenyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 10324760 |
| Molecular Formula | C23H16ClF6N3O3 |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 2-[4-[1-[[4-chloro-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]ethyl]phenyl]-4-fluorobenzoic acid |
| SMILES | CC(Nc1nccc(Cl)c1NC(=O)C(F)(F)C(F)(F)F)c1ccc(-c2cc(F)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H16ClF6N3O3/c1-11(12-2-4-13(5-3-12)16-10-14(25)6-7-15(16)20(34)35)32-19-18(17(24)8-9-31-19)33-21(36)22(26,27)23(28,29)30/h2-11H,1H3,(H,31,32)(H,33,36)(H,34,35) |
| InChIKey | GFHCMODNWCGOQJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|